C20H26O3 — CID 57418029
[(2E,6E)-2,6-dimethyl-10-oxoundeca-2,6-dienyl] benzoate (PubChem CID 57418029) has the molecular formula C20H26O3 and a molecular weight of 314.42 g/mol. Its IUPAC name is [(2E,6E)-2,6-dimethyl-10-oxoundeca-2,6-dienyl] benzoate.
| Compound Name | [(2E,6E)-2,6-dimethyl-10-oxoundeca-2,6-dienyl] benzoate |
|---|---|
| PubChem CID | 57418029 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | [(2E,6E)-2,6-dimethyl-10-oxoundeca-2,6-dienyl] benzoate |
| SMILES | CC(=O)CC/C=C(\C)CC/C=C(\C)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H26O3/c1-16(10-8-12-18(3)21)9-7-11-17(2)15-23-20(22)19-13-5-4-6-14-19/h4-6,10-11,13-14H,7-9,12,15H2,1-3H3/b16-10+,17-11+ |
| InChIKey | AHCRIYLDRFPMFP-OTYYAQKOSA-N |
| XLogP | 4.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|