C41H46O6 — CID 70558302
[(2E,6Z,10E,14Z)-16-benzoyloxy-7-(benzoyloxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] benzoate (PubChem CID 70558302) has the molecular formula C41H46O6 and a molecular weight of 634.81 g/mol. Its IUPAC name is [(2E,6Z,10E,14Z)-16-benzoyloxy-7-(benzoyloxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] benzoate.
| Compound Name | [(2E,6Z,10E,14Z)-16-benzoyloxy-7-(benzoyloxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] benzoate |
|---|---|
| PubChem CID | 70558302 |
| Molecular Formula | C41H46O6 |
| Molecular Weight | 634.81 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | [(2E,6Z,10E,14Z)-16-benzoyloxy-7-(benzoyloxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] benzoate |
| SMILES | C/C(=C/CC/C(C)=C/CC/C(=C/CC/C(C)=C/COC(=O)c1ccccc1)COC(=O)c1ccccc1)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C41H46O6/c1-32(16-13-19-34(3)30-46-40(43)37-24-9-5-10-25-37)17-14-20-35(31-47-41(44)38-26-11-6-12-27-38)21-15-18-33(2)28-29-45-39(42)36-22-7-4-8-23-36/h4-12,17,19,21-28H,13-16,18,20,29-31H2,1-3H3/b32-17+,33-28+,34-19-,35-21- |
| InChIKey | MLBQNAGQLOSMQQ-XPXIKKCISA-N |
| XLogP | 9.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.81 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|