C31H40O2 — CID 67644130
[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] naphthalene-1-carboxylate (PubChem CID 67644130) has the molecular formula C31H40O2 and a molecular weight of 444.66 g/mol. Its IUPAC name is [(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] naphthalene-1-carboxylate.
| Compound Name | [(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 67644130 |
| Molecular Formula | C31H40O2 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | [(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] naphthalene-1-carboxylate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/COC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C31H40O2/c1-24(2)12-8-13-25(3)14-9-15-26(4)16-10-17-27(5)22-23-33-31(32)30-21-11-19-28-18-6-7-20-29(28)30/h6-7,11-12,14,16,18-22H,8-10,13,15,17,23H2,1-5H3/b25-14+,26-16+,27-22+ |
| InChIKey | VJDOUVPLKZHJAR-CBJNVDPLSA-N |
| XLogP | 9.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|