C28H40O4S — CID 67642806
[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] 4-methylsulfonylbenzoate (PubChem CID 67642806) has the molecular formula C28H40O4S and a molecular weight of 472.69 g/mol. Its IUPAC name is [(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] 4-methylsulfonylbenzoate.
| Compound Name | [(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 67642806 |
| Molecular Formula | C28H40O4S |
| Molecular Weight | 472.69 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | [(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] 4-methylsulfonylbenzoate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/COC(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C28H40O4S/c1-22(2)10-7-11-23(3)12-8-13-24(4)14-9-15-25(5)20-21-32-28(29)26-16-18-27(19-17-26)33(6,30)31/h10,12,14,16-20H,7-9,11,13,15,21H2,1-6H3/b23-12+,24-14+,25-20+ |
| InChIKey | QCMZGIBASIYSPC-NHLAYJJJSA-N |
| XLogP | 7.39 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.69 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|