C27H37NO4 — CID 54105007
3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl 2-nitrobenzoate (PubChem CID 54105007) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is 3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl 2-nitrobenzoate.
| Compound Name | 3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl 2-nitrobenzoate |
|---|---|
| PubChem CID | 54105007 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl 2-nitrobenzoate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H37NO4/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-16-24(5)19-20-32-27(29)25-17-6-7-18-26(25)28(30)31/h6-7,11,13,15,17-19H,8-10,12,14,16,20H2,1-5H3 |
| InChIKey | NDDDOHKHUXRTKZ-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|