C19H25NO3 — CID 72641597
3,7-dimethylocta-2,6-dienyl 2-(methylcarbamoyl)benzoate (PubChem CID 72641597) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 3,7-dimethylocta-2,6-dienyl 2-(methylcarbamoyl)benzoate.
| Compound Name | 3,7-dimethylocta-2,6-dienyl 2-(methylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 72641597 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 3,7-dimethylocta-2,6-dienyl 2-(methylcarbamoyl)benzoate |
| SMILES | CNC(=O)c1ccccc1C(=O)OCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C19H25NO3/c1-14(2)8-7-9-15(3)12-13-23-19(22)17-11-6-5-10-16(17)18(21)20-4/h5-6,8,10-12H,7,9,13H2,1-4H3,(H,20,21) |
| InChIKey | BRFLGZGPTUUEIX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|