C23H33NOS — CID 74403172
N-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzamide (PubChem CID 74403172) has the molecular formula C23H33NOS and a molecular weight of 371.59 g/mol. Its IUPAC name is N-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzamide.
| Compound Name | N-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzamide |
|---|---|
| PubChem CID | 74403172 |
| Molecular Formula | C23H33NOS |
| Molecular Weight | 371.59 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | N-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzamide |
| SMILES | CNC(=O)c1ccccc1SCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C23H33NOS/c1-18(2)10-8-11-19(3)12-9-13-20(4)16-17-26-22-15-7-6-14-21(22)23(25)24-5/h6-7,10,12,14-16H,8-9,11,13,17H2,1-5H3,(H,24,25) |
| InChIKey | UATVIEUDDKLRJY-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|