C24H36O3S — CID 89054178
1-(methylperoxymethoxymethyl)-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzene (PubChem CID 89054178) has the molecular formula C24H36O3S and a molecular weight of 404.62 g/mol. Its IUPAC name is 1-(methylperoxymethoxymethyl)-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzene.
| Compound Name | 1-(methylperoxymethoxymethyl)-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzene |
|---|---|
| PubChem CID | 89054178 |
| Molecular Formula | C24H36O3S |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 1-(methylperoxymethoxymethyl)-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzene |
| SMILES | COOCOCc1ccccc1SC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C24H36O3S/c1-20(2)10-8-11-21(3)12-9-13-22(4)16-17-28-24-15-7-6-14-23(24)18-26-19-27-25-5/h6-7,10,12,14-16H,8-9,11,13,17-19H2,1-5H3/b21-12+,22-16+ |
| InChIKey | UPAMFESXTQZJLM-PMPJFHHKSA-N |
| XLogP | 7.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|