C27H42 — CID 158695222
ethane;[(6E,10E)-7,11,15-trimethylhexadeca-3,6,10,14-tetraen-2-yl]benzene (PubChem CID 158695222) has the molecular formula C27H42 and a molecular weight of 366.63 g/mol. Its IUPAC name is ethane;[(6E,10E)-7,11,15-trimethylhexadeca-3,6,10,14-tetraen-2-yl]benzene.
| Compound Name | ethane;[(6E,10E)-7,11,15-trimethylhexadeca-3,6,10,14-tetraen-2-yl]benzene |
|---|---|
| PubChem CID | 158695222 |
| Molecular Formula | C27H42 |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.33 |
| IUPAC Name | ethane;[(6E,10E)-7,11,15-trimethylhexadeca-3,6,10,14-tetraen-2-yl]benzene |
| SMILES | CC.CC(C)=CCC/C(C)=C/CC/C(C)=C/CC=CC(C)c1ccccc1 |
| InChI | InChI=1S/C25H36.C2H6/c1-21(2)13-11-15-23(4)17-12-16-22(3)14-9-10-18-24(5)25-19-7-6-8-20-25;1-2/h6-8,10,13-14,17-20,24H,9,11-12,15-16H2,1-5H3;1-2H3/b18-10?,22-14+,23-17+; |
| InChIKey | IGVUORUXUZHSOO-RLGBTTNLSA-N |
| XLogP | 9.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|