C24H34O3S — CID 68789854
3-(methoxymethyl)-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzoic acid (PubChem CID 68789854) has the molecular formula C24H34O3S and a molecular weight of 402.60 g/mol. Its IUPAC name is 3-(methoxymethyl)-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzoic acid.
| Compound Name | 3-(methoxymethyl)-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 68789854 |
| Molecular Formula | C24H34O3S |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 3-(methoxymethyl)-2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzoic acid |
| SMILES | COCc1cccc(C(=O)O)c1SCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C24H34O3S/c1-18(2)9-6-10-19(3)11-7-12-20(4)15-16-28-23-21(17-27-5)13-8-14-22(23)24(25)26/h8-9,11,13-15H,6-7,10,12,16-17H2,1-5H3,(H,25,26) |
| InChIKey | YDJPQKBRJXGDQT-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|