C30H47O6PS — CID 123684102
4-diethoxyphosphoryloxybutyl 2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzoate (PubChem CID 123684102) has the molecular formula C30H47O6PS and a molecular weight of 566.74 g/mol. Its IUPAC name is 4-diethoxyphosphoryloxybutyl 2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzoate.
| Compound Name | 4-diethoxyphosphoryloxybutyl 2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzoate |
|---|---|
| PubChem CID | 123684102 |
| Molecular Formula | C30H47O6PS |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | 4-diethoxyphosphoryloxybutyl 2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)benzoate |
| SMILES | CCOP(=O)(OCC)OCCCCOC(=O)c1ccccc1SCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C30H47O6PS/c1-7-34-37(32,35-8-2)36-23-12-11-22-33-30(31)28-19-9-10-20-29(28)38-24-21-27(6)18-14-17-26(5)16-13-15-25(3)4/h9-10,15,17,19-21H,7-8,11-14,16,18,22-24H2,1-6H3 |
| InChIKey | NRBSBBCDQNEWED-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|