C34H48NO6P — CID 123607281
diethyl 2-[4-[[2-(3,7,11-trimethyldodeca-2,6,10-trienoxy)benzoyl]amino]phenyl]ethyl phosphate (PubChem CID 123607281) has the molecular formula C34H48NO6P and a molecular weight of 597.73 g/mol. Its IUPAC name is diethyl 2-[4-[[2-(3,7,11-trimethyldodeca-2,6,10-trienoxy)benzoyl]amino]phenyl]ethyl phosphate.
| Compound Name | diethyl 2-[4-[[2-(3,7,11-trimethyldodeca-2,6,10-trienoxy)benzoyl]amino]phenyl]ethyl phosphate |
|---|---|
| PubChem CID | 123607281 |
| Molecular Formula | C34H48NO6P |
| Molecular Weight | 597.73 g/mol |
| Exact Mass | 597.32 |
| IUPAC Name | diethyl 2-[4-[[2-(3,7,11-trimethyldodeca-2,6,10-trienoxy)benzoyl]amino]phenyl]ethyl phosphate |
| SMILES | CCOP(=O)(OCC)OCCc1ccc(NC(=O)c2ccccc2OCC=C(C)CCC=C(C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C34H48NO6P/c1-7-39-42(37,40-8-2)41-26-24-30-19-21-31(22-20-30)35-34(36)32-17-9-10-18-33(32)38-25-23-29(6)16-12-15-28(5)14-11-13-27(3)4/h9-10,13,15,17-23H,7-8,11-12,14,16,24-26H2,1-6H3,(H,35,36) |
| InChIKey | VXUUGECSDZXZLU-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.73 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|