C39H60NO4PS — CID 144735116
(Z)-but-2-ene;diethyl [4-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]phenyl]methyl phosphite;ethane (PubChem CID 144735116) has the molecular formula C39H60NO4PS and a molecular weight of 669.95 g/mol. Its IUPAC name is (Z)-but-2-ene;diethyl [4-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]phenyl]methyl phosphite;ethane.
| Compound Name | (Z)-but-2-ene;diethyl [4-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]phenyl]methyl phosphite;ethane |
|---|---|
| PubChem CID | 144735116 |
| Molecular Formula | C39H60NO4PS |
| Molecular Weight | 669.95 g/mol |
| Exact Mass | 669.40 |
| IUPAC Name | (Z)-but-2-ene;diethyl [4-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]phenyl]methyl phosphite;ethane |
| SMILES | C/C=C\C.CC.CCOP(OCC)OCc1ccc(NC(=O)c2ccccc2SC/C=C(\C)CC/C=C(\C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C33H46NO4PS.C4H8.C2H6/c1-7-36-39(37-8-2)38-25-29-19-21-30(22-20-29)34-33(35)31-17-9-10-18-32(31)40-24-23-28(6)16-12-15-27(5)14-11-13-26(3)4;1-3-4-2;1-2/h9-10,13,15,17-23H,7-8,11-12,14,16,24-25H2,1-6H3,(H,34,35);3-4H,1-2H3;1-2H3/b27-15+,28-23+;4-3-; |
| InChIKey | SONNBQIGJYLIQU-HFOBIGFDSA-N |
| XLogP | 12.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.95 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|