C26H38N2O2S — CID 146359004
2-amino-N-[3-oxo-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-yl]benzamide (PubChem CID 146359004) has the molecular formula C26H38N2O2S and a molecular weight of 442.67 g/mol. Its IUPAC name is 2-amino-N-[3-oxo-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-yl]benzamide.
| Compound Name | 2-amino-N-[3-oxo-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 146359004 |
| Molecular Formula | C26H38N2O2S |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 2-amino-N-[3-oxo-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbutan-2-yl]benzamide |
| SMILES | CC(=O)C(CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)NC(=O)c1ccccc1N |
| InChI | InChI=1S/C26H38N2O2S/c1-19(2)10-8-11-20(3)12-9-13-21(4)16-17-31-18-25(22(5)29)28-26(30)23-14-6-7-15-24(23)27/h6-7,10,12,14-16,25H,8-9,11,13,17-18,27H2,1-5H3,(H,28,30)/b20-12+,21-16+ |
| InChIKey | TWKGWFYAHJEKHU-FJNYLYSMSA-N |
| XLogP | 6.11 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|