C31H40N2O3S — CID 42612757
(2R)-2-[(2-anilinobenzoyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 42612757) has the molecular formula C31H40N2O3S and a molecular weight of 520.74 g/mol. Its IUPAC name is (2R)-2-[(2-anilinobenzoyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-[(2-anilinobenzoyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 42612757 |
| Molecular Formula | C31H40N2O3S |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | (2R)-2-[(2-anilinobenzoyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NC(=O)c1ccccc1Nc1ccccc1)C(=O)O |
| InChI | InChI=1S/C31H40N2O3S/c1-23(2)12-10-13-24(3)14-11-15-25(4)20-21-37-22-29(31(35)36)33-30(34)27-18-8-9-19-28(27)32-26-16-6-5-7-17-26/h5-9,12,14,16-20,29,32H,10-11,13,15,21-22H2,1-4H3,(H,33,34)(H,35,36)/b24-14+,25-20+/t29-/m0/s1 |
| InChIKey | UAEJYCPBBDCBFA-XNZXZYHPSA-N |
| XLogP | 7.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|