C31H40N2O3S — CID 123430277
(2R)-2-(diphenylcarbamoylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid (PubChem CID 123430277) has the molecular formula C31H40N2O3S and a molecular weight of 520.74 g/mol. Its IUPAC name is (2R)-2-(diphenylcarbamoylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-(diphenylcarbamoylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 123430277 |
| Molecular Formula | C31H40N2O3S |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | (2R)-2-(diphenylcarbamoylamino)-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCSC[C@H](NC(=O)N(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C31H40N2O3S/c1-24(2)13-11-14-25(3)15-12-16-26(4)21-22-37-23-29(30(34)35)32-31(36)33(27-17-7-5-8-18-27)28-19-9-6-10-20-28/h5-10,13,15,17-21,29H,11-12,14,16,22-23H2,1-4H3,(H,32,36)(H,34,35)/t29-/m0/s1 |
| InChIKey | IFDBGPMIIPTPKA-LJAQVGFWSA-N |
| XLogP | 8.14 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|