C31H40N2O7S — CID 143996599
5-[[1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-(1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid (PubChem CID 143996599) has the molecular formula C31H40N2O7S and a molecular weight of 584.74 g/mol. Its IUPAC name is 5-[[1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-(1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid.
| Compound Name | 5-[[1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-(1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 143996599 |
| Molecular Formula | C31H40N2O7S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | 5-[[1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-(1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCC(NC(=O)CCC(C(=O)O)N1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C31H40N2O7S/c1-20(2)9-7-10-21(3)11-8-12-22(4)17-18-41-19-25(30(37)38)32-27(34)16-15-26(31(39)40)33-28(35)23-13-5-6-14-24(23)29(33)36/h5-6,9,11,13-14,17,25-26H,7-8,10,12,15-16,18-19H2,1-4H3,(H,32,34)(H,37,38)(H,39,40)/b21-11+,22-17+ |
| InChIKey | WVZFNWKZCUTRJM-CZYWBIRRSA-N |
| XLogP | 5.24 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|