C26H39N3O4S — CID 161346229
(2R)-2-acetamido-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid;pyridine-3-carboxamide (PubChem CID 161346229) has the molecular formula C26H39N3O4S and a molecular weight of 489.68 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid;pyridine-3-carboxamide.
| Compound Name | (2R)-2-acetamido-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid;pyridine-3-carboxamide |
|---|---|
| PubChem CID | 161346229 |
| Molecular Formula | C26H39N3O4S |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | (2R)-2-acetamido-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid;pyridine-3-carboxamide |
| SMILES | CC(=O)N[C@@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O.NC(=O)c1cccnc1 |
| InChI | InChI=1S/C20H33NO3S.C6H6N2O/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-25-14-19(20(23)24)21-18(5)22;7-6(9)5-2-1-3-8-4-5/h8,10,12,19H,6-7,9,11,13-14H2,1-5H3,(H,21,22)(H,23,24);1-4H,(H2,7,9)/b16-10+,17-12+;/t19-;/m0./s1 |
| InChIKey | VNIDMKDULHSQSV-MSRDNXCRSA-N |
| XLogP | 4.91 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|