C29H47NO3S — CID 87839002
(2R)-2-acetamido-3-[(2Z,6E,10E)-7,11,15-trimethyl-3-(3-methylbut-2-enyl)hexadeca-2,6,10,14-tetraenyl]sulfanylpropanoic acid (PubChem CID 87839002) has the molecular formula C29H47NO3S and a molecular weight of 489.77 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(2Z,6E,10E)-7,11,15-trimethyl-3-(3-methylbut-2-enyl)hexadeca-2,6,10,14-tetraenyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(2Z,6E,10E)-7,11,15-trimethyl-3-(3-methylbut-2-enyl)hexadeca-2,6,10,14-tetraenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87839002 |
| Molecular Formula | C29H47NO3S |
| Molecular Weight | 489.77 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | (2R)-2-acetamido-3-[(2Z,6E,10E)-7,11,15-trimethyl-3-(3-methylbut-2-enyl)hexadeca-2,6,10,14-tetraenyl]sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CSC/C=C(\CC=C(C)C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C29H47NO3S/c1-22(2)11-8-12-24(5)13-9-14-25(6)15-10-16-27(18-17-23(3)4)19-20-34-21-28(29(32)33)30-26(7)31/h11,13,15,17,19,28H,8-10,12,14,16,18,20-21H2,1-7H3,(H,30,31)(H,32,33)/b24-13+,25-15+,27-19-/t28-/m0/s1 |
| InChIKey | CRHVLNFWRLMCRQ-FTAXWCKQSA-N |
| XLogP | 7.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.77 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|