C27H40N2O2S — CID 58167614
3-[(2Z,6E)-7,11-dimethyl-3-(3-methylbut-2-enyl)dodeca-2,6,10-trienyl]sulfanyl-2-(pyridin-2-ylamino)propanoic acid (PubChem CID 58167614) has the molecular formula C27H40N2O2S and a molecular weight of 456.70 g/mol. Its IUPAC name is 3-[(2Z,6E)-7,11-dimethyl-3-(3-methylbut-2-enyl)dodeca-2,6,10-trienyl]sulfanyl-2-(pyridin-2-ylamino)propanoic acid.
| Compound Name | 3-[(2Z,6E)-7,11-dimethyl-3-(3-methylbut-2-enyl)dodeca-2,6,10-trienyl]sulfanyl-2-(pyridin-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 58167614 |
| Molecular Formula | C27H40N2O2S |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 3-[(2Z,6E)-7,11-dimethyl-3-(3-methylbut-2-enyl)dodeca-2,6,10-trienyl]sulfanyl-2-(pyridin-2-ylamino)propanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(=C/CSCC(Nc1ccccn1)C(=O)O)CC=C(C)C |
| InChI | InChI=1S/C27H40N2O2S/c1-21(2)10-8-11-23(5)12-9-13-24(16-15-22(3)4)17-19-32-20-25(27(30)31)29-26-14-6-7-18-28-26/h6-7,10,12,14-15,17-18,25H,8-9,11,13,16,19-20H2,1-5H3,(H,28,29)(H,30,31)/b23-12+,24-17- |
| InChIKey | VRFLANQFUWNOTG-CZYIYVETSA-N |
| XLogP | 7.44 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|