C25H38N4O2S — CID 123363161
N-carbamoyl-2-[(3-methyl-2-pyridinyl)amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanamide (PubChem CID 123363161) has the molecular formula C25H38N4O2S and a molecular weight of 458.67 g/mol. Its IUPAC name is N-carbamoyl-2-[(3-methyl-2-pyridinyl)amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanamide.
| Compound Name | N-carbamoyl-2-[(3-methyl-2-pyridinyl)amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanamide |
|---|---|
| PubChem CID | 123363161 |
| Molecular Formula | C25H38N4O2S |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | N-carbamoyl-2-[(3-methyl-2-pyridinyl)amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanamide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCSCC(Nc1ncccc1C)C(=O)NC(N)=O |
| InChI | InChI=1S/C25H38N4O2S/c1-18(2)9-6-10-19(3)11-7-12-20(4)14-16-32-17-22(24(30)29-25(26)31)28-23-21(5)13-8-15-27-23/h8-9,11,13-15,22H,6-7,10,12,16-17H2,1-5H3,(H,27,28)(H3,26,29,30,31) |
| InChIKey | BKIQLEXQHPGCNI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|