C25H35NO4S2 — CID 143996634
2-[[1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]sulfanylbenzoic acid (PubChem CID 143996634) has the molecular formula C25H35NO4S2 and a molecular weight of 477.69 g/mol. Its IUPAC name is 2-[[1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]sulfanylbenzoic acid.
| Compound Name | 2-[[1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 143996634 |
| Molecular Formula | C25H35NO4S2 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 2-[[1-carboxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]sulfanylbenzoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCC(NSc1ccccc1C(=O)O)C(=O)O |
| InChI | InChI=1S/C25H35NO4S2/c1-18(2)9-7-10-19(3)11-8-12-20(4)15-16-31-17-22(25(29)30)26-32-23-14-6-5-13-21(23)24(27)28/h5-6,9,11,13-15,22,26H,7-8,10,12,16-17H2,1-4H3,(H,27,28)(H,29,30)/b19-11+,20-15+ |
| InChIKey | WOWIVJRTKZPWRX-NKFKFSAASA-N |
| XLogP | 6.59 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|