C34H48N2O2S — CID 134568334
2-[5-(1,3-dimethylideneisoindol-2-yl)hex-1-en-2-ylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 134568334) has the molecular formula C34H48N2O2S and a molecular weight of 548.84 g/mol. Its IUPAC name is 2-[5-(1,3-dimethylideneisoindol-2-yl)hex-1-en-2-ylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | 2-[5-(1,3-dimethylideneisoindol-2-yl)hex-1-en-2-ylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 134568334 |
| Molecular Formula | C34H48N2O2S |
| Molecular Weight | 548.84 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | 2-[5-(1,3-dimethylideneisoindol-2-yl)hex-1-en-2-ylamino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | C=C(CCC(C)n1c(=C)c2ccccc2c1=C)NC(CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C34H48N2O2S/c1-24(2)13-11-14-25(3)15-12-16-26(4)21-22-39-23-33(34(37)38)35-27(5)19-20-28(6)36-29(7)31-17-9-10-18-32(31)30(36)8/h9-10,13,15,17-18,21,28,33,35H,5,7-8,11-12,14,16,19-20,22-23H2,1-4,6H3,(H,37,38)/b25-15+,26-21+ |
| InChIKey | VTLWHPNJURHGSS-QZELQNEBSA-N |
| XLogP | 7.51 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.84 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|