C28H41IN2O5S2 — CID 89051023
(2R)-2-[[(2R,3R)-2-(benzenesulfonamido)-3-iodobutanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 89051023) has the molecular formula C28H41IN2O5S2 and a molecular weight of 676.68 g/mol. Its IUPAC name is (2R)-2-[[(2R,3R)-2-(benzenesulfonamido)-3-iodobutanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2R,3R)-2-(benzenesulfonamido)-3-iodobutanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 89051023 |
| Molecular Formula | C28H41IN2O5S2 |
| Molecular Weight | 676.68 g/mol |
| Exact Mass | 676.15 |
| IUPAC Name | (2R)-2-[[(2R,3R)-2-(benzenesulfonamido)-3-iodobutanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NC(=O)[C@@H](NS(=O)(=O)c1ccccc1)[C@@H](C)I)C(=O)O |
| InChI | InChI=1S/C28H41IN2O5S2/c1-20(2)11-9-12-21(3)13-10-14-22(4)17-18-37-19-25(28(33)34)30-27(32)26(23(5)29)31-38(35,36)24-15-7-6-8-16-24/h6-8,11,13,15-17,23,25-26,31H,9-10,12,14,18-19H2,1-5H3,(H,30,32)(H,33,34)/b21-13+,22-17+/t23-,25+,26+/m1/s1 |
| InChIKey | YHDFFQBNWCAXDP-DUQZCEERSA-N |
| XLogP | 5.88 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.68 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|