C38H52N2O5S — CID 130368663
(2R)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 130368663) has the molecular formula C38H52N2O5S and a molecular weight of 648.91 g/mol. Its IUPAC name is (2R)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 130368663 |
| Molecular Formula | C38H52N2O5S |
| Molecular Weight | 648.91 g/mol |
| Exact Mass | 648.36 |
| IUPAC Name | (2R)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NC(=O)C(NC(=O)OC(C)(C)C)C(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C38H52N2O5S/c1-27(2)16-14-17-28(3)18-15-19-29(4)24-25-46-26-32(36(42)43)39-35(41)34(40-37(44)45-38(5,6)7)33(30-20-10-8-11-21-30)31-22-12-9-13-23-31/h8-13,16,18,20-24,32-34H,14-15,17,19,25-26H2,1-7H3,(H,39,41)(H,40,44)(H,42,43)/b28-18+,29-24+/t32-,34?/m0/s1 |
| InChIKey | YOLOODZBBFOMSG-RWBWSBKGSA-N |
| XLogP | 8.43 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.91 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|