C28H47NO6S — CID 147064472
(2R)-2-[[(2S)-2-(1-hydroxyethyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 147064472) has the molecular formula C28H47NO6S and a molecular weight of 525.75 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-(1-hydroxyethyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-(1-hydroxyethyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 147064472 |
| Molecular Formula | C28H47NO6S |
| Molecular Weight | 525.75 g/mol |
| Exact Mass | 525.31 |
| IUPAC Name | (2R)-2-[[(2S)-2-(1-hydroxyethyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NC(=O)[C@@H](CC(=O)OC(C)(C)C)C(C)O)C(=O)O |
| InChI | InChI=1S/C28H47NO6S/c1-19(2)11-9-12-20(3)13-10-14-21(4)15-16-36-18-24(27(33)34)29-26(32)23(22(5)30)17-25(31)35-28(6,7)8/h11,13,15,22-24,30H,9-10,12,14,16-18H2,1-8H3,(H,29,32)(H,33,34)/b20-13+,21-15+/t22?,23-,24-/m0/s1 |
| InChIKey | BDUNRZVUYBURGP-QDONOHJBSA-N |
| XLogP | 5.44 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.75 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|