C27H46N2O4S — CID 130368693
(2R)-2-[[(3S)-2-[acetyl(methyl)amino]-3-methylpentanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 130368693) has the molecular formula C27H46N2O4S and a molecular weight of 494.74 g/mol. Its IUPAC name is (2R)-2-[[(3S)-2-[acetyl(methyl)amino]-3-methylpentanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(3S)-2-[acetyl(methyl)amino]-3-methylpentanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 130368693 |
| Molecular Formula | C27H46N2O4S |
| Molecular Weight | 494.74 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | (2R)-2-[[(3S)-2-[acetyl(methyl)amino]-3-methylpentanoyl]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC[C@H](C)C(C(=O)N[C@@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O)N(C)C(C)=O |
| InChI | InChI=1S/C27H46N2O4S/c1-9-22(6)25(29(8)23(7)30)26(31)28-24(27(32)33)18-34-17-16-21(5)15-11-14-20(4)13-10-12-19(2)3/h12,14,16,22,24-25H,9-11,13,15,17-18H2,1-8H3,(H,28,31)(H,32,33)/b20-14+,21-16+/t22-,24-,25?/m0/s1 |
| InChIKey | YJSCGUHFKMFSSE-UYLZHJRMSA-N |
| XLogP | 5.60 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.74 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|