C25H44N2O5S2 — CID 75148595
2-[[2-(methanesulfonamido)-3-methylpentanoyl]amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid (PubChem CID 75148595) has the molecular formula C25H44N2O5S2 and a molecular weight of 516.77 g/mol. Its IUPAC name is 2-[[2-(methanesulfonamido)-3-methylpentanoyl]amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid.
| Compound Name | 2-[[2-(methanesulfonamido)-3-methylpentanoyl]amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 75148595 |
| Molecular Formula | C25H44N2O5S2 |
| Molecular Weight | 516.77 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 2-[[2-(methanesulfonamido)-3-methylpentanoyl]amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid |
| SMILES | CCC(C)C(NS(C)(=O)=O)C(=O)NC(CSCC=C(C)CCC=C(C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C25H44N2O5S2/c1-8-21(6)23(27-34(7,31)32)24(28)26-22(25(29)30)17-33-16-15-20(5)14-10-13-19(4)12-9-11-18(2)3/h11,13,15,21-23,27H,8-10,12,14,16-17H2,1-7H3,(H,26,28)(H,29,30) |
| InChIKey | MOSLTBORJKLTOS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|