C35H54N2O7S — CID 91367827
2-[[5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypentanoyl]amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid (PubChem CID 91367827) has the molecular formula C35H54N2O7S and a molecular weight of 646.89 g/mol. Its IUPAC name is 2-[[5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypentanoyl]amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid.
| Compound Name | 2-[[5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypentanoyl]amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 91367827 |
| Molecular Formula | C35H54N2O7S |
| Molecular Weight | 646.89 g/mol |
| Exact Mass | 646.37 |
| IUPAC Name | 2-[[5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypentanoyl]amino]-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propanoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCSCC(NC(=O)C(CCC(O)OCc1ccccc1)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C35H54N2O7S/c1-25(2)13-11-14-26(3)15-12-16-27(4)21-22-45-24-30(33(40)41)36-32(39)29(37-34(42)44-35(5,6)7)19-20-31(38)43-23-28-17-9-8-10-18-28/h8-10,13,15,17-18,21,29-31,38H,11-12,14,16,19-20,22-24H2,1-7H3,(H,36,39)(H,37,42)(H,40,41) |
| InChIKey | VBQUUPHUJVCEPH-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.89 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|