C28H50N2O5S — CID 146359020
tert-butyl N-[(2S)-1-[[(2R)-1,1-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 146359020) has the molecular formula C28H50N2O5S and a molecular weight of 526.78 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2R)-1,1-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2R)-1,1-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 146359020 |
| Molecular Formula | C28H50N2O5S |
| Molecular Weight | 526.78 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2R)-1,1-dihydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)C(O)O |
| InChI | InChI=1S/C28H50N2O5S/c1-19(2)12-10-13-21(5)14-11-15-22(6)16-17-36-18-23(26(32)33)29-25(31)24(20(3)4)30-27(34)35-28(7,8)9/h12,14,16,20,23-24,26,32-33H,10-11,13,15,17-18H2,1-9H3,(H,29,31)(H,30,34)/b21-14+,22-16+/t23-,24-/m0/s1 |
| InChIKey | WOASQTAXQFSLRM-IBHFAOMJSA-N |
| XLogP | 5.48 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.78 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|