C20H35NO4S2 — CID 11091097
methyl (2R)-2-(methanesulfonamido)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate (PubChem CID 11091097) has the molecular formula C20H35NO4S2 and a molecular weight of 420.54 g/mol. Its IUPAC name is methyl (2R)-2-(methanesulfonamido)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate.
| Compound Name | methyl (2R)-2-(methanesulfonamido)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 11091097 |
| Molecular Formula | C20H35NO4S2 |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | methyl (2R)-2-(methanesulfonamido)-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate |
| SMILES | COC(=O)[C@H](CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)N[35S](C)(=O)=O |
| InChI | InChI=1S/C20H35NO4S2/c1-16(2)9-7-10-17(3)11-8-12-18(4)13-14-26-15-19(20(22)25-5)21-27(6,23)24/h9,11,13,19,21H,7-8,10,12,14-15H2,1-6H3/b17-11+,18-13+/t19-/m0/s1/i27+3 |
| InChIKey | RSFJMZMMTRTJCU-JPJRJJCRSA-N |
| XLogP | 4.23 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|