C22H37N3O3S — CID 90697724
N-[(2R)-1-(2-acetylhydrazinyl)-1-oxo-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-yl]acetamide (PubChem CID 90697724) has the molecular formula C22H37N3O3S and a molecular weight of 423.62 g/mol. Its IUPAC name is N-[(2R)-1-(2-acetylhydrazinyl)-1-oxo-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-yl]acetamide.
| Compound Name | N-[(2R)-1-(2-acetylhydrazinyl)-1-oxo-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 90697724 |
| Molecular Formula | C22H37N3O3S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | N-[(2R)-1-(2-acetylhydrazinyl)-1-oxo-3-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-yl]acetamide |
| SMILES | CC(=O)NNC(=O)[C@H](CSCC=C(C)CCC=C(C)CCC=C(C)C)NC(C)=O |
| InChI | InChI=1S/C22H37N3O3S/c1-16(2)9-7-10-17(3)11-8-12-18(4)13-14-29-15-21(23-19(5)26)22(28)25-24-20(6)27/h9,11,13,21H,7-8,10,12,14-15H2,1-6H3,(H,23,26)(H,24,27)(H,25,28)/t21-/m0/s1 |
| InChIKey | RORCUPPXYWQTSY-NRFANRHFSA-N |
| XLogP | 3.81 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|