C26H44N2O2S — CID 134568437
2-formamido-3-methyl-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]butanamide (PubChem CID 134568437) has the molecular formula C26H44N2O2S and a molecular weight of 448.72 g/mol. Its IUPAC name is 2-formamido-3-methyl-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]butanamide.
| Compound Name | 2-formamido-3-methyl-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]butanamide |
|---|---|
| PubChem CID | 134568437 |
| Molecular Formula | C26H44N2O2S |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.31 |
| IUPAC Name | 2-formamido-3-methyl-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]butanamide |
| SMILES | C=C(C)C(CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)NC(=O)C(NC=O)C(C)C |
| InChI | InChI=1S/C26H44N2O2S/c1-19(2)11-9-12-22(7)13-10-14-23(8)15-16-31-17-24(20(3)4)28-26(30)25(21(5)6)27-18-29/h11,13,15,18,21,24-25H,3,9-10,12,14,16-17H2,1-2,4-8H3,(H,27,29)(H,28,30)/b22-13+,23-15+ |
| InChIKey | HXALVBASKVSZIG-JWIKZEKMSA-N |
| XLogP | 5.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|