C24H41N3O3S — CID 143996658
2-formamido-N'-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]pentanediamide (PubChem CID 143996658) has the molecular formula C24H41N3O3S and a molecular weight of 451.68 g/mol. Its IUPAC name is 2-formamido-N'-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]pentanediamide.
| Compound Name | 2-formamido-N'-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 143996658 |
| Molecular Formula | C24H41N3O3S |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | 2-formamido-N'-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]pentanediamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCC(C)NC(=O)CCC(NC=O)C(N)=O |
| InChI | InChI=1S/C24H41N3O3S/c1-18(2)8-6-9-19(3)10-7-11-20(4)14-15-31-16-21(5)27-23(29)13-12-22(24(25)30)26-17-28/h8,10,14,17,21-22H,6-7,9,11-13,15-16H2,1-5H3,(H2,25,30)(H,26,28)(H,27,29)/b19-10+,20-14+ |
| InChIKey | IDXSRCJRWYJEFN-GNUCVDFRSA-N |
| XLogP | 4.02 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|