C30H51NS — CID 143849763
(2E)-5-methyl-N-[1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylpropan-2-yl]hexa-2,4-dien-2-amine (PubChem CID 143849763) has the molecular formula C30H51NS and a molecular weight of 457.81 g/mol. Its IUPAC name is (2E)-5-methyl-N-[1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylpropan-2-yl]hexa-2,4-dien-2-amine.
| Compound Name | (2E)-5-methyl-N-[1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylpropan-2-yl]hexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 143849763 |
| Molecular Formula | C30H51NS |
| Molecular Weight | 457.81 g/mol |
| Exact Mass | 457.37 |
| IUPAC Name | (2E)-5-methyl-N-[1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylpropan-2-yl]hexa-2,4-dien-2-amine |
| SMILES | CC(C)=C/C=C(\C)NC(C)CSC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H51NS/c1-24(2)13-10-14-26(5)15-11-16-27(6)17-12-18-28(7)21-22-32-23-30(9)31-29(8)20-19-25(3)4/h13,15,17,19-21,30-31H,10-12,14,16,18,22-23H2,1-9H3/b26-15+,27-17+,28-21+,29-20+ |
| InChIKey | XQGBOIVIKSCNBJ-OCYXFFSVSA-N |
| XLogP | 9.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.81 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|