C23H40N2O2S — CID 134568411
3-acetamido-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]propanamide (PubChem CID 134568411) has the molecular formula C23H40N2O2S and a molecular weight of 408.65 g/mol. Its IUPAC name is 3-acetamido-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]propanamide.
| Compound Name | 3-acetamido-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]propanamide |
|---|---|
| PubChem CID | 134568411 |
| Molecular Formula | C23H40N2O2S |
| Molecular Weight | 408.65 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 3-acetamido-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]propanamide |
| SMILES | CC(=O)NCCC(=O)NC(C)CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C23H40N2O2S/c1-18(2)9-7-10-19(3)11-8-12-20(4)14-16-28-17-21(5)25-23(27)13-15-24-22(6)26/h9,11,14,21H,7-8,10,12-13,15-17H2,1-6H3,(H,24,26)(H,25,27)/b19-11+,20-14+ |
| InChIKey | KWJWROGFHQHDGD-CXBQNDLOSA-N |
| XLogP | 5.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|