C22H37N3O3S — CID 146358930
4-hydrazinyl-4-oxo-N-[1-oxo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]butanamide (PubChem CID 146358930) has the molecular formula C22H37N3O3S and a molecular weight of 423.62 g/mol. Its IUPAC name is 4-hydrazinyl-4-oxo-N-[1-oxo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]butanamide.
| Compound Name | 4-hydrazinyl-4-oxo-N-[1-oxo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]butanamide |
|---|---|
| PubChem CID | 146358930 |
| Molecular Formula | C22H37N3O3S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 4-hydrazinyl-4-oxo-N-[1-oxo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]butanamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCC(C=O)NC(=O)CCC(=O)NN |
| InChI | InChI=1S/C22H37N3O3S/c1-17(2)7-5-8-18(3)9-6-10-19(4)13-14-29-16-20(15-26)24-21(27)11-12-22(28)25-23/h7,9,13,15,20H,5-6,8,10-12,14,16,23H2,1-4H3,(H,24,27)(H,25,28)/b18-9+,19-13+ |
| InChIKey | BGRCYOMZDSKVGN-RPSHFMPKSA-N |
| XLogP | 3.59 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|