C18H31NO2S — CID 46926172
(2R)-2-azaniumyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate (PubChem CID 46926172) has the molecular formula C18H31NO2S and a molecular weight of 325.52 g/mol. Its IUPAC name is (2R)-2-azaniumyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate.
| Compound Name | (2R)-2-azaniumyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 46926172 |
| Molecular Formula | C18H31NO2S |
| Molecular Weight | 325.52 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | (2R)-2-azaniumyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C18H31NO2S/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-22-13-17(19)18(20)21/h7,9,11,17H,5-6,8,10,12-13,19H2,1-4H3,(H,20,21)/b15-9+,16-11+/t17-/m0/s1 |
| InChIKey | SYSLNQMKLROGCL-BCYUYYMPSA-N |
| XLogP | 2.50 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|