C25H42N2O2S — CID 58167730
2-(1-aminoethylideneamino)-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylpropanoic acid (PubChem CID 58167730) has the molecular formula C25H42N2O2S and a molecular weight of 434.69 g/mol. Its IUPAC name is 2-(1-aminoethylideneamino)-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylpropanoic acid.
| Compound Name | 2-(1-aminoethylideneamino)-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 58167730 |
| Molecular Formula | C25H42N2O2S |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 2-(1-aminoethylideneamino)-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CSCC(/N=C(\C)N)C(=O)O |
| InChI | InChI=1S/C25H42N2O2S/c1-19(2)10-7-11-20(3)12-8-13-21(4)14-9-15-22(5)16-17-30-18-24(25(28)29)27-23(6)26/h10,12,14,16,24H,7-9,11,13,15,17-18H2,1-6H3,(H2,26,27)(H,28,29)/b20-12+,21-14+,22-16+ |
| InChIKey | HIQQEJIXAHXSKW-VOLDSXALSA-N |
| XLogP | 6.70 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|