C23H38N2O2S — CID 173475322
2-(aminomethylideneamino)-3-(2,6,10,14-tetramethylpentadeca-1,5,9,13-tetraenylsulfanyl)propanoic acid (PubChem CID 173475322) has the molecular formula C23H38N2O2S and a molecular weight of 406.64 g/mol. Its IUPAC name is 2-(aminomethylideneamino)-3-(2,6,10,14-tetramethylpentadeca-1,5,9,13-tetraenylsulfanyl)propanoic acid.
| Compound Name | 2-(aminomethylideneamino)-3-(2,6,10,14-tetramethylpentadeca-1,5,9,13-tetraenylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 173475322 |
| Molecular Formula | C23H38N2O2S |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 2-(aminomethylideneamino)-3-(2,6,10,14-tetramethylpentadeca-1,5,9,13-tetraenylsulfanyl)propanoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CSCC(/N=C/N)C(=O)O |
| InChI | InChI=1S/C23H38N2O2S/c1-18(2)9-6-10-19(3)11-7-12-20(4)13-8-14-21(5)15-28-16-22(23(26)27)25-17-24/h9,11,13,15,17,22H,6-8,10,12,14,16H2,1-5H3,(H2,24,25)(H,26,27) |
| InChIKey | LUXWWRQCFQEPJP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|