C25H48N2O2S — CID 76691913
2-(1-aminoethylideneamino)-3-(3,7,11,15-tetramethylhexadec-2-enylsulfanyl)propanoic acid (PubChem CID 76691913) has the molecular formula C25H48N2O2S and a molecular weight of 440.74 g/mol. Its IUPAC name is 2-(1-aminoethylideneamino)-3-(3,7,11,15-tetramethylhexadec-2-enylsulfanyl)propanoic acid.
| Compound Name | 2-(1-aminoethylideneamino)-3-(3,7,11,15-tetramethylhexadec-2-enylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 76691913 |
| Molecular Formula | C25H48N2O2S |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 440.34 |
| IUPAC Name | 2-(1-aminoethylideneamino)-3-(3,7,11,15-tetramethylhexadec-2-enylsulfanyl)propanoic acid |
| SMILES | CC(=CCSCC(/N=C(\C)N)C(=O)O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C25H48N2O2S/c1-19(2)10-7-11-20(3)12-8-13-21(4)14-9-15-22(5)16-17-30-18-24(25(28)29)27-23(6)26/h16,19-21,24H,7-15,17-18H2,1-6H3,(H2,26,27)(H,28,29) |
| InChIKey | RTHDHAAJQULOIO-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|