C28H53NOS — CID 134568341
4-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-ylamino]pent-4-enal (PubChem CID 134568341) has the molecular formula C28H53NOS and a molecular weight of 451.81 g/mol. Its IUPAC name is 4-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-ylamino]pent-4-enal.
| Compound Name | 4-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-ylamino]pent-4-enal |
|---|---|
| PubChem CID | 134568341 |
| Molecular Formula | C28H53NOS |
| Molecular Weight | 451.81 g/mol |
| Exact Mass | 451.38 |
| IUPAC Name | 4-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-ylamino]pent-4-enal |
| SMILES | C=C(CCC=O)NC(C)CSC/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C28H53NOS/c1-23(2)12-8-13-24(3)14-9-15-25(4)16-10-17-26(5)19-21-31-22-28(7)29-27(6)18-11-20-30/h19-20,23-25,28-29H,6,8-18,21-22H2,1-5,7H3/b26-19+ |
| InChIKey | PEXPMWMRXUMOOP-LGUFXXKBSA-N |
| XLogP | 8.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.81 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|