C30H54N2O5S — CID 135232401
1-[[1-carboxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylethyl]carbamoyl]piperidine-3-carboxylic acid (PubChem CID 135232401) has the molecular formula C30H54N2O5S and a molecular weight of 554.84 g/mol. Its IUPAC name is 1-[[1-carboxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylethyl]carbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[[1-carboxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylethyl]carbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 135232401 |
| Molecular Formula | C30H54N2O5S |
| Molecular Weight | 554.84 g/mol |
| Exact Mass | 554.38 |
| IUPAC Name | 1-[[1-carboxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylethyl]carbamoyl]piperidine-3-carboxylic acid |
| SMILES | C/C(=C\CSCC(NC(=O)N1CCCC(C(=O)O)C1)C(=O)O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C30H54N2O5S/c1-22(2)10-6-11-23(3)12-7-13-24(4)14-8-15-25(5)17-19-38-21-27(29(35)36)31-30(37)32-18-9-16-26(20-32)28(33)34/h17,22-24,26-27H,6-16,18-21H2,1-5H3,(H,31,37)(H,33,34)(H,35,36)/b25-17+ |
| InChIKey | SVZQRXCEOCDCKG-KOEQRZSOSA-N |
| XLogP | 7.06 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.84 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|