C33H63NO5S — CID 167642969
10-[[1-carboxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylethyl]amino]-10-oxodecanoic acid;molecular hydrogen (PubChem CID 167642969) has the molecular formula C33H63NO5S and a molecular weight of 585.94 g/mol. Its IUPAC name is 10-[[1-carboxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylethyl]amino]-10-oxodecanoic acid;molecular hydrogen.
| Compound Name | 10-[[1-carboxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylethyl]amino]-10-oxodecanoic acid;molecular hydrogen |
|---|---|
| PubChem CID | 167642969 |
| Molecular Formula | C33H63NO5S |
| Molecular Weight | 585.94 g/mol |
| Exact Mass | 585.44 |
| IUPAC Name | 10-[[1-carboxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylethyl]amino]-10-oxodecanoic acid;molecular hydrogen |
| SMILES | C/C(=C\CSCC(NC(=O)CCCCCCCCC(=O)O)C(=O)O)CCCC(C)CCCC(C)CCCC(C)C.[H][H] |
| InChI | InChI=1S/C33H61NO5S.H2/c1-26(2)15-12-16-27(3)17-13-18-28(4)19-14-20-29(5)23-24-40-25-30(33(38)39)34-31(35)21-10-8-6-7-9-11-22-32(36)37;/h23,26-28,30H,6-22,24-25H2,1-5H3,(H,34,35)(H,36,37)(H,38,39);1H/b29-23+; |
| InChIKey | PKWNJTSXTOSJDY-BTCGTBLPSA-N |
| XLogP | 9.13 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.94 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|