C29H53NO5S — CID 122606179
methyl 2-[(5-hydroxy-4-oxopentanoyl)amino]-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoate (PubChem CID 122606179) has the molecular formula C29H53NO5S and a molecular weight of 527.81 g/mol. Its IUPAC name is methyl 2-[(5-hydroxy-4-oxopentanoyl)amino]-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoate.
| Compound Name | methyl 2-[(5-hydroxy-4-oxopentanoyl)amino]-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 122606179 |
| Molecular Formula | C29H53NO5S |
| Molecular Weight | 527.81 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | methyl 2-[(5-hydroxy-4-oxopentanoyl)amino]-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoate |
| SMILES | COC(=O)C(CSC/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C)NC(=O)CCC(=O)CO |
| InChI | InChI=1S/C29H53NO5S/c1-22(2)10-7-11-23(3)12-8-13-24(4)14-9-15-25(5)18-19-36-21-27(29(34)35-6)30-28(33)17-16-26(32)20-31/h18,22-24,27,31H,7-17,19-21H2,1-6H3,(H,30,33)/b25-18+ |
| InChIKey | XODBIKIPBOLUQN-XIEYBQDHSA-N |
| XLogP | 6.10 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.81 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|