C35H58N2O6S — CID 172994537
methyl 2-[[2-acetamido-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 172994537) has the molecular formula C35H58N2O6S and a molecular weight of 634.92 g/mol. Its IUPAC name is methyl 2-[[2-acetamido-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | methyl 2-[[2-acetamido-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 172994537 |
| Molecular Formula | C35H58N2O6S |
| Molecular Weight | 634.92 g/mol |
| Exact Mass | 634.40 |
| IUPAC Name | methyl 2-[[2-acetamido-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(O)c(O)c1)NC(=O)C(CSC/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C)NC(C)=O |
| InChI | InChI=1S/C35H58N2O6S/c1-24(2)11-8-12-25(3)13-9-14-26(4)15-10-16-27(5)19-20-44-23-31(36-28(6)38)34(41)37-30(35(42)43-7)21-29-17-18-32(39)33(40)22-29/h17-19,22,24-26,30-31,39-40H,8-16,20-21,23H2,1-7H3,(H,36,38)(H,37,41)/b27-19+ |
| InChIKey | MMKWZAYDWLLPRT-ZXVVBBHZSA-N |
| XLogP | 6.92 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.92 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|