C30H43NO5 — CID 70493961
methyl (2S)-3-(3,4-dihydroxyphenyl)-2-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoylamino)propanoate (PubChem CID 70493961) has the molecular formula C30H43NO5 and a molecular weight of 497.68 g/mol. Its IUPAC name is methyl (2S)-3-(3,4-dihydroxyphenyl)-2-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoylamino)propanoate.
| Compound Name | methyl (2S)-3-(3,4-dihydroxyphenyl)-2-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoylamino)propanoate |
|---|---|
| PubChem CID | 70493961 |
| Molecular Formula | C30H43NO5 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.31 |
| IUPAC Name | methyl (2S)-3-(3,4-dihydroxyphenyl)-2-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)c(O)c1)NC(=O)C=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C30H43NO5/c1-21(2)10-7-11-22(3)12-8-13-23(4)14-9-15-24(5)18-29(34)31-26(30(35)36-6)19-25-16-17-27(32)28(33)20-25/h10,12,14,16-18,20,26,32-33H,7-9,11,13,15,19H2,1-6H3,(H,31,34)/t26-/m0/s1 |
| InChIKey | HZWBQHLBXHETNL-SANMLTNESA-N |
| XLogP | 6.44 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|