C19H21NO6 — CID 75001961
methyl 3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enylamino]propanoate (PubChem CID 75001961) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is methyl 3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enylamino]propanoate.
| Compound Name | methyl 3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enylamino]propanoate |
|---|---|
| PubChem CID | 75001961 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | methyl 3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)prop-2-enylamino]propanoate |
| SMILES | COC(=O)C(Cc1ccc(O)c(O)c1)NCC=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H21NO6/c1-26-19(25)14(9-13-5-7-16(22)18(24)11-13)20-8-2-3-12-4-6-15(21)17(23)10-12/h2-7,10-11,14,20-24H,8-9H2,1H3 |
| InChIKey | XTAZDMIBNIHBGF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|