C17H19NO5 — CID 175247547
benzaldehyde;methyl 2-amino-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 175247547) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is benzaldehyde;methyl 2-amino-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | benzaldehyde;methyl 2-amino-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 175247547 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | benzaldehyde;methyl 2-amino-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | COC(=O)C(N)Cc1ccc(O)c(O)c1.O=Cc1ccccc1 |
| InChI | InChI=1S/C10H13NO4.C7H6O/c1-15-10(14)7(11)4-6-2-3-8(12)9(13)5-6;8-6-7-4-2-1-3-5-7/h2-3,5,7,12-13H,4,11H2,1H3;1-6H |
| InChIKey | MMLXEEQXRSOMLO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|