C11H13NO3 — CID 123194061
methyl (2S)-2-amino-3-(3-formylphenyl)propanoate (PubChem CID 123194061) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(3-formylphenyl)propanoate.
| Compound Name | methyl (2S)-2-amino-3-(3-formylphenyl)propanoate |
|---|---|
| PubChem CID | 123194061 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | methyl (2S)-2-amino-3-(3-formylphenyl)propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1cccc(C=O)c1 |
| InChI | InChI=1S/C11H13NO3/c1-15-11(14)10(12)6-8-3-2-4-9(5-8)7-13/h2-5,7,10H,6,12H2,1H3/t10-/m0/s1 |
| InChIKey | CMAIEMLDZQKZIW-JTQLQIEISA-N |
| XLogP | 0.54 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|